C27H23Cl2N3O5S2 — CID 43846788
8-(2,3-dichlorophenyl)-11-(4-methylphenyl)-4-(2-morpholin-4-yl-2-oxoethyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione (PubChem CID 43846788) has the molecular formula C27H23Cl2N3O5S2 and a molecular weight of 604.54 g/mol. Its IUPAC name is 8-(2,3-dichlorophenyl)-11-(4-methylphenyl)-4-(2-morpholin-4-yl-2-oxoethyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione.
| Compound Name | 8-(2,3-dichlorophenyl)-11-(4-methylphenyl)-4-(2-morpholin-4-yl-2-oxoethyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
|---|---|
| PubChem CID | 43846788 |
| Molecular Formula | C27H23Cl2N3O5S2 |
| Molecular Weight | 604.54 g/mol |
| Exact Mass | 603.05 |
| IUPAC Name | 8-(2,3-dichlorophenyl)-11-(4-methylphenyl)-4-(2-morpholin-4-yl-2-oxoethyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
| SMILES | Cc1ccc(N2C(=O)C3Sc4c(sc(=O)n4CC(=O)N4CCOCC4)C(c4cccc(Cl)c4Cl)C3C2=O)cc1 |
| InChI | InChI=1S/C27H23Cl2N3O5S2/c1-14-5-7-15(8-6-14)32-24(34)20-19(16-3-2-4-17(28)21(16)29)23-26(38-22(20)25(32)35)31(27(36)39-23)13-18(33)30-9-11-37-12-10-30/h2-8,19-20,22H,9-13H2,1H3 |
| InChIKey | UNXUQXQSARPFKW-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 88.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.54 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|