C28H27N3O5S2 — CID 18862123
(1S,8R,9S)-8-(2-hydroxyphenyl)-11-(4-methylphenyl)-4-(2-oxo-2-piperidin-1-ylethyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione (PubChem CID 18862123) has the molecular formula C28H27N3O5S2 and a molecular weight of 549.67 g/mol. Its IUPAC name is (1S,8R,9S)-8-(2-hydroxyphenyl)-11-(4-methylphenyl)-4-(2-oxo-2-piperidin-1-ylethyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione.
| Compound Name | (1S,8R,9S)-8-(2-hydroxyphenyl)-11-(4-methylphenyl)-4-(2-oxo-2-piperidin-1-ylethyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
|---|---|
| PubChem CID | 18862123 |
| Molecular Formula | C28H27N3O5S2 |
| Molecular Weight | 549.67 g/mol |
| Exact Mass | 549.14 |
| IUPAC Name | (1S,8R,9S)-8-(2-hydroxyphenyl)-11-(4-methylphenyl)-4-(2-oxo-2-piperidin-1-ylethyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
| SMILES | Cc1ccc(N2C(=O)[C@@H]3[C@H](c4ccccc4O)c4sc(=O)n(CC(=O)N5CCCCC5)c4S[C@@H]3C2=O)cc1 |
| InChI | InChI=1S/C28H27N3O5S2/c1-16-9-11-17(12-10-16)31-25(34)22-21(18-7-3-4-8-19(18)32)24-27(37-23(22)26(31)35)30(28(36)38-24)15-20(33)29-13-5-2-6-14-29/h3-4,7-12,21-23,32H,2,5-6,13-15H2,1H3/t21-,22+,23-/m0/s1 |
| InChIKey | KXUKTSNPXUNIQO-ZRBLBEILSA-N |
| XLogP | 3.73 |
| TPSA | 99.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.67 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|