C28H24F3N3O5S2 — CID 21226981
8-(2-hydroxyphenyl)-4-(2-oxo-2-piperidin-1-ylethyl)-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione (PubChem CID 21226981) has the molecular formula C28H24F3N3O5S2 and a molecular weight of 603.64 g/mol. Its IUPAC name is 8-(2-hydroxyphenyl)-4-(2-oxo-2-piperidin-1-ylethyl)-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione.
| Compound Name | 8-(2-hydroxyphenyl)-4-(2-oxo-2-piperidin-1-ylethyl)-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
|---|---|
| PubChem CID | 21226981 |
| Molecular Formula | C28H24F3N3O5S2 |
| Molecular Weight | 603.64 g/mol |
| Exact Mass | 603.11 |
| IUPAC Name | 8-(2-hydroxyphenyl)-4-(2-oxo-2-piperidin-1-ylethyl)-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
| SMILES | O=C(Cn1c2c(sc1=O)C(c1ccccc1O)C1C(=O)N(c3cccc(C(F)(F)F)c3)C(=O)C1S2)N1CCCCC1 |
| InChI | InChI=1S/C28H24F3N3O5S2/c29-28(30,31)15-7-6-8-16(13-15)34-24(37)21-20(17-9-2-3-10-18(17)35)23-26(40-22(21)25(34)38)33(27(39)41-23)14-19(36)32-11-4-1-5-12-32/h2-3,6-10,13,20-22,35H,1,4-5,11-12,14H2 |
| InChIKey | PVVVSWLHBRSGKY-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 99.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.64 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|