C32H33F3N4O4S2 — CID 19248677
(1R,8R,9R)-8-[4-(diethylamino)phenyl]-4-(2-oxo-2-piperidin-1-ylethyl)-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione (PubChem CID 19248677) has the molecular formula C32H33F3N4O4S2 and a molecular weight of 658.77 g/mol. Its IUPAC name is (1R,8R,9R)-8-[4-(diethylamino)phenyl]-4-(2-oxo-2-piperidin-1-ylethyl)-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione.
| Compound Name | (1R,8R,9R)-8-[4-(diethylamino)phenyl]-4-(2-oxo-2-piperidin-1-ylethyl)-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
|---|---|
| PubChem CID | 19248677 |
| Molecular Formula | C32H33F3N4O4S2 |
| Molecular Weight | 658.77 g/mol |
| Exact Mass | 658.19 |
| IUPAC Name | (1R,8R,9R)-8-[4-(diethylamino)phenyl]-4-(2-oxo-2-piperidin-1-ylethyl)-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
| SMILES | CCN(CC)c1ccc([C@@H]2c3sc(=O)n(CC(=O)N4CCCCC4)c3S[C@H]3C(=O)N(c4cccc(C(F)(F)F)c4)C(=O)[C@@H]23)cc1 |
| InChI | InChI=1S/C32H33F3N4O4S2/c1-3-36(4-2)21-13-11-19(12-14-21)24-25-26(29(42)39(28(25)41)22-10-8-9-20(17-22)32(33,34)35)44-30-27(24)45-31(43)38(30)18-23(40)37-15-6-5-7-16-37/h8-14,17,24-26H,3-7,15-16,18H2,1-2H3/t24-,25-,26+/m0/s1 |
| InChIKey | KCQNHVNOZVMKEJ-KKUQBAQOSA-N |
| XLogP | 5.58 |
| TPSA | 82.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.77 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|