C37H31F3N4O4S2 — CID 16635418
2-[(8S)-8-[4-(diethylamino)phenyl]-5,10,12-trioxo-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-naphthalen-2-ylacetamide (PubChem CID 16635418) has the molecular formula C37H31F3N4O4S2 and a molecular weight of 716.81 g/mol. Its IUPAC name is 2-[(8S)-8-[4-(diethylamino)phenyl]-5,10,12-trioxo-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-naphthalen-2-ylacetamide.
| Compound Name | 2-[(8S)-8-[4-(diethylamino)phenyl]-5,10,12-trioxo-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-naphthalen-2-ylacetamide |
|---|---|
| PubChem CID | 16635418 |
| Molecular Formula | C37H31F3N4O4S2 |
| Molecular Weight | 716.81 g/mol |
| Exact Mass | 716.17 |
| IUPAC Name | 2-[(8S)-8-[4-(diethylamino)phenyl]-5,10,12-trioxo-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-naphthalen-2-ylacetamide |
| SMILES | CCN(CC)c1ccc([C@H]2c3sc(=O)n(CC(=O)Nc4ccc5ccccc5c4)c3SC3C(=O)N(c4cccc(C(F)(F)F)c4)C(=O)C32)cc1 |
| InChI | InChI=1S/C37H31F3N4O4S2/c1-3-42(4-2)26-16-13-22(14-17-26)29-30-31(34(47)44(33(30)46)27-11-7-10-24(19-27)37(38,39)40)49-35-32(29)50-36(48)43(35)20-28(45)41-25-15-12-21-8-5-6-9-23(21)18-25/h5-19,29-31H,3-4,20H2,1-2H3,(H,41,45)/t29-,30?,31?/m1/s1 |
| InChIKey | LVZKGRIAOQMUAN-QCKVGYCISA-N |
| XLogP | 7.36 |
| TPSA | 91.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.81 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|