C29H19F4N3O4S2 — CID 19248603
N-(4-fluorophenyl)-2-[(1R,8R,9R)-5,10,12-trioxo-8-phenyl-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide (PubChem CID 19248603) has the molecular formula C29H19F4N3O4S2 and a molecular weight of 613.61 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[(1R,8R,9R)-5,10,12-trioxo-8-phenyl-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide.
| Compound Name | N-(4-fluorophenyl)-2-[(1R,8R,9R)-5,10,12-trioxo-8-phenyl-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide |
|---|---|
| PubChem CID | 19248603 |
| Molecular Formula | C29H19F4N3O4S2 |
| Molecular Weight | 613.61 g/mol |
| Exact Mass | 613.08 |
| IUPAC Name | N-(4-fluorophenyl)-2-[(1R,8R,9R)-5,10,12-trioxo-8-phenyl-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide |
| SMILES | O=C(Cn1c2c(sc1=O)[C@@H](c1ccccc1)[C@@H]1C(=O)N(c3cccc(C(F)(F)F)c3)C(=O)[C@@H]1S2)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C29H19F4N3O4S2/c30-17-9-11-18(12-10-17)34-20(37)14-35-27-24(42-28(35)40)21(15-5-2-1-3-6-15)22-23(41-27)26(39)36(25(22)38)19-8-4-7-16(13-19)29(31,32)33/h1-13,21-23H,14H2,(H,34,37)/t21-,22-,23+/m0/s1 |
| InChIKey | WSBQTIHKNYUFIN-RJGXRXQPSA-N |
| XLogP | 5.50 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.61 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|