C29H20F3N3O4S2 — CID 103596680
N-phenyl-2-[(8S)-5,10,12-trioxo-8-phenyl-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide (PubChem CID 103596680) has the molecular formula C29H20F3N3O4S2 and a molecular weight of 595.62 g/mol. Its IUPAC name is N-phenyl-2-[(8S)-5,10,12-trioxo-8-phenyl-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide.
| Compound Name | N-phenyl-2-[(8S)-5,10,12-trioxo-8-phenyl-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide |
|---|---|
| PubChem CID | 103596680 |
| Molecular Formula | C29H20F3N3O4S2 |
| Molecular Weight | 595.62 g/mol |
| Exact Mass | 595.08 |
| IUPAC Name | N-phenyl-2-[(8S)-5,10,12-trioxo-8-phenyl-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide |
| SMILES | O=C(Cn1c2c(sc1=O)[C@H](c1ccccc1)C1C(=O)N(c3cccc(C(F)(F)F)c3)C(=O)C1S2)Nc1ccccc1 |
| InChI | InChI=1S/C29H20F3N3O4S2/c30-29(31,32)17-10-7-13-19(14-17)35-25(37)22-21(16-8-3-1-4-9-16)24-27(40-23(22)26(35)38)34(28(39)41-24)15-20(36)33-18-11-5-2-6-12-18/h1-14,21-23H,15H2,(H,33,36)/t21-,22?,23?/m1/s1 |
| InChIKey | QOQKKAIFPBAONP-DDRJZQQSSA-N |
| XLogP | 5.36 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.62 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|