C33H28BrF3N4O4S2 — CID 16634648
2-[(8S)-11-(4-bromophenyl)-8-[4-(diethylamino)phenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 16634648) has the molecular formula C33H28BrF3N4O4S2 and a molecular weight of 745.64 g/mol. Its IUPAC name is 2-[(8S)-11-(4-bromophenyl)-8-[4-(diethylamino)phenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[(8S)-11-(4-bromophenyl)-8-[4-(diethylamino)phenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 16634648 |
| Molecular Formula | C33H28BrF3N4O4S2 |
| Molecular Weight | 745.64 g/mol |
| Exact Mass | 744.07 |
| IUPAC Name | 2-[(8S)-11-(4-bromophenyl)-8-[4-(diethylamino)phenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | CCN(CC)c1ccc([C@H]2c3sc(=O)n(CC(=O)Nc4cccc(C(F)(F)F)c4)c3SC3C(=O)N(c4ccc(Br)cc4)C(=O)C32)cc1 |
| InChI | InChI=1S/C33H28BrF3N4O4S2/c1-3-39(4-2)22-12-8-18(9-13-22)25-26-27(30(44)41(29(26)43)23-14-10-20(34)11-15-23)46-31-28(25)47-32(45)40(31)17-24(42)38-21-7-5-6-19(16-21)33(35,36)37/h5-16,25-27H,3-4,17H2,1-2H3,(H,38,42)/t25-,26?,27?/m1/s1 |
| InChIKey | YSCPFEMXRSSTPQ-FKDZAPPDSA-N |
| XLogP | 6.97 |
| TPSA | 91.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.64 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|