C32H27F3N4O4S2 — CID 43847795
2-[8-[4-(dimethylamino)phenyl]-5,10,12-trioxo-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(3-methylphenyl)acetamide (PubChem CID 43847795) has the molecular formula C32H27F3N4O4S2 and a molecular weight of 652.72 g/mol. Its IUPAC name is 2-[8-[4-(dimethylamino)phenyl]-5,10,12-trioxo-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(3-methylphenyl)acetamide.
| Compound Name | 2-[8-[4-(dimethylamino)phenyl]-5,10,12-trioxo-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 43847795 |
| Molecular Formula | C32H27F3N4O4S2 |
| Molecular Weight | 652.72 g/mol |
| Exact Mass | 652.14 |
| IUPAC Name | 2-[8-[4-(dimethylamino)phenyl]-5,10,12-trioxo-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(3-methylphenyl)acetamide |
| SMILES | Cc1cccc(NC(=O)Cn2c3c(sc2=O)C(c2ccc(N(C)C)cc2)C2C(=O)N(c4cccc(C(F)(F)F)c4)C(=O)C2S3)c1 |
| InChI | InChI=1S/C32H27F3N4O4S2/c1-17-6-4-8-20(14-17)36-23(40)16-38-30-27(45-31(38)43)24(18-10-12-21(13-11-18)37(2)3)25-26(44-30)29(42)39(28(25)41)22-9-5-7-19(15-22)32(33,34)35/h4-15,24-26H,16H2,1-3H3,(H,36,40) |
| InChIKey | GRJZUJSABHMBCK-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 91.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.72 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|