C34H31F3N4O4S2 — CID 43846766
2-[8-[4-(diethylamino)phenyl]-11-(4-methylphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 43846766) has the molecular formula C34H31F3N4O4S2 and a molecular weight of 680.77 g/mol. Its IUPAC name is 2-[8-[4-(diethylamino)phenyl]-11-(4-methylphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[8-[4-(diethylamino)phenyl]-11-(4-methylphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 43846766 |
| Molecular Formula | C34H31F3N4O4S2 |
| Molecular Weight | 680.77 g/mol |
| Exact Mass | 680.17 |
| IUPAC Name | 2-[8-[4-(diethylamino)phenyl]-11-(4-methylphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | CCN(CC)c1ccc(C2c3sc(=O)n(CC(=O)Nc4cccc(C(F)(F)F)c4)c3SC3C(=O)N(c4ccc(C)cc4)C(=O)C32)cc1 |
| InChI | InChI=1S/C34H31F3N4O4S2/c1-4-39(5-2)23-15-11-20(12-16-23)26-27-28(31(44)41(30(27)43)24-13-9-19(3)10-14-24)46-32-29(26)47-33(45)40(32)18-25(42)38-22-8-6-7-21(17-22)34(35,36)37/h6-17,26-28H,4-5,18H2,1-3H3,(H,38,42) |
| InChIKey | BUUIWCMZJGFESC-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 91.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.77 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|