C33H31ClN4O4S2 — CID 19247237
N-(4-chlorophenyl)-2-[(1R,8R,9R)-8-[4-(diethylamino)phenyl]-11-(4-methylphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide (PubChem CID 19247237) has the molecular formula C33H31ClN4O4S2 and a molecular weight of 647.22 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[(1R,8R,9R)-8-[4-(diethylamino)phenyl]-11-(4-methylphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide.
| Compound Name | N-(4-chlorophenyl)-2-[(1R,8R,9R)-8-[4-(diethylamino)phenyl]-11-(4-methylphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide |
|---|---|
| PubChem CID | 19247237 |
| Molecular Formula | C33H31ClN4O4S2 |
| Molecular Weight | 647.22 g/mol |
| Exact Mass | 646.15 |
| IUPAC Name | N-(4-chlorophenyl)-2-[(1R,8R,9R)-8-[4-(diethylamino)phenyl]-11-(4-methylphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide |
| SMILES | CCN(CC)c1ccc([C@@H]2c3sc(=O)n(CC(=O)Nc4ccc(Cl)cc4)c3S[C@H]3C(=O)N(c4ccc(C)cc4)C(=O)[C@@H]23)cc1 |
| InChI | InChI=1S/C33H31ClN4O4S2/c1-4-36(5-2)23-16-8-20(9-17-23)26-27-28(31(41)38(30(27)40)24-14-6-19(3)7-15-24)43-32-29(26)44-33(42)37(32)18-25(39)35-22-12-10-21(34)11-13-22/h6-17,26-28H,4-5,18H2,1-3H3,(H,35,39)/t26-,27-,28+/m0/s1 |
| InChIKey | RJJGOZLYDYHKRT-HZFUHODCSA-N |
| XLogP | 6.15 |
| TPSA | 91.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.22 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|