C34H34N4O4S2 — CID 16634553
2-[(8S)-8-[4-(diethylamino)phenyl]-11-(4-methylphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(2-methylphenyl)acetamide (PubChem CID 16634553) has the molecular formula C34H34N4O4S2 and a molecular weight of 626.80 g/mol. Its IUPAC name is 2-[(8S)-8-[4-(diethylamino)phenyl]-11-(4-methylphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(2-methylphenyl)acetamide.
| Compound Name | 2-[(8S)-8-[4-(diethylamino)phenyl]-11-(4-methylphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 16634553 |
| Molecular Formula | C34H34N4O4S2 |
| Molecular Weight | 626.80 g/mol |
| Exact Mass | 626.20 |
| IUPAC Name | 2-[(8S)-8-[4-(diethylamino)phenyl]-11-(4-methylphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(2-methylphenyl)acetamide |
| SMILES | CCN(CC)c1ccc([C@H]2c3sc(=O)n(CC(=O)Nc4ccccc4C)c3SC3C(=O)N(c4ccc(C)cc4)C(=O)C32)cc1 |
| InChI | InChI=1S/C34H34N4O4S2/c1-5-36(6-2)23-17-13-22(14-18-23)27-28-29(32(41)38(31(28)40)24-15-11-20(3)12-16-24)43-33-30(27)44-34(42)37(33)19-26(39)35-25-10-8-7-9-21(25)4/h7-18,27-29H,5-6,19H2,1-4H3,(H,35,39)/t27-,28?,29?/m1/s1 |
| InChIKey | XZQBXUVJODKQFN-JMYZALGVSA-N |
| XLogP | 5.81 |
| TPSA | 91.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.80 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|