C28H20F3N3O5S2 — CID 19248750
2-[(1R,8R,9R)-8-(furan-2-yl)-5,10,12-trioxo-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(3-methylphenyl)acetamide (PubChem CID 19248750) has the molecular formula C28H20F3N3O5S2 and a molecular weight of 599.61 g/mol. Its IUPAC name is 2-[(1R,8R,9R)-8-(furan-2-yl)-5,10,12-trioxo-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(3-methylphenyl)acetamide.
| Compound Name | 2-[(1R,8R,9R)-8-(furan-2-yl)-5,10,12-trioxo-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 19248750 |
| Molecular Formula | C28H20F3N3O5S2 |
| Molecular Weight | 599.61 g/mol |
| Exact Mass | 599.08 |
| IUPAC Name | 2-[(1R,8R,9R)-8-(furan-2-yl)-5,10,12-trioxo-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(3-methylphenyl)acetamide |
| SMILES | Cc1cccc(NC(=O)Cn2c3c(sc2=O)[C@@H](c2ccco2)[C@@H]2C(=O)N(c4cccc(C(F)(F)F)c4)C(=O)[C@@H]2S3)c1 |
| InChI | InChI=1S/C28H20F3N3O5S2/c1-14-5-2-7-16(11-14)32-19(35)13-33-26-23(41-27(33)38)20(18-9-4-10-39-18)21-22(40-26)25(37)34(24(21)36)17-8-3-6-15(12-17)28(29,30)31/h2-12,20-22H,13H2,1H3,(H,32,35)/t20-,21-,22+/m0/s1 |
| InChIKey | ZSRQKALBKQCNOJ-FDFHNCONSA-N |
| XLogP | 5.26 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.61 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|