C27H21N3O5S2 — CID 43848184
2-[8-(furan-2-yl)-5,10,12-trioxo-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-methylphenyl)acetamide (PubChem CID 43848184) has the molecular formula C27H21N3O5S2 and a molecular weight of 531.62 g/mol. Its IUPAC name is 2-[8-(furan-2-yl)-5,10,12-trioxo-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[8-(furan-2-yl)-5,10,12-trioxo-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 43848184 |
| Molecular Formula | C27H21N3O5S2 |
| Molecular Weight | 531.62 g/mol |
| Exact Mass | 531.09 |
| IUPAC Name | 2-[8-(furan-2-yl)-5,10,12-trioxo-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)Cn2c3c(sc2=O)C(c2ccco2)C2C(=O)N(c4ccccc4)C(=O)C2S3)cc1 |
| InChI | InChI=1S/C27H21N3O5S2/c1-15-9-11-16(12-10-15)28-19(31)14-29-26-23(37-27(29)34)20(18-8-5-13-35-18)21-22(36-26)25(33)30(24(21)32)17-6-3-2-4-7-17/h2-13,20-22H,14H2,1H3,(H,28,31) |
| InChIKey | XCQGCZXNKQZWFY-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.62 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|