C27H20ClN3O6S2 — CID 19247895
2-[(1R,8R,9R)-11-(4-chlorophenyl)-8-(furan-2-yl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-methoxyphenyl)acetamide (PubChem CID 19247895) has the molecular formula C27H20ClN3O6S2 and a molecular weight of 582.06 g/mol. Its IUPAC name is 2-[(1R,8R,9R)-11-(4-chlorophenyl)-8-(furan-2-yl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-[(1R,8R,9R)-11-(4-chlorophenyl)-8-(furan-2-yl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 19247895 |
| Molecular Formula | C27H20ClN3O6S2 |
| Molecular Weight | 582.06 g/mol |
| Exact Mass | 581.05 |
| IUPAC Name | 2-[(1R,8R,9R)-11-(4-chlorophenyl)-8-(furan-2-yl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)Cn2c3c(sc2=O)[C@@H](c2ccco2)[C@@H]2C(=O)N(c4ccc(Cl)cc4)C(=O)[C@@H]2S3)cc1 |
| InChI | InChI=1S/C27H20ClN3O6S2/c1-36-17-10-6-15(7-11-17)29-19(32)13-30-26-23(39-27(30)35)20(18-3-2-12-37-18)21-22(38-26)25(34)31(24(21)33)16-8-4-14(28)5-9-16/h2-12,20-22H,13H2,1H3,(H,29,32)/t20-,21-,22+/m0/s1 |
| InChIKey | PHIUUNIAJWZCBB-FDFHNCONSA-N |
| XLogP | 4.60 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.06 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|