C27H22N4O8S3 — CID 16635536
2-[(8S)-8-(furan-2-yl)-11-(4-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-sulfamoylphenyl)acetamide (PubChem CID 16635536) has the molecular formula C27H22N4O8S3 and a molecular weight of 626.69 g/mol. Its IUPAC name is 2-[(8S)-8-(furan-2-yl)-11-(4-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-sulfamoylphenyl)acetamide.
| Compound Name | 2-[(8S)-8-(furan-2-yl)-11-(4-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 16635536 |
| Molecular Formula | C27H22N4O8S3 |
| Molecular Weight | 626.69 g/mol |
| Exact Mass | 626.06 |
| IUPAC Name | 2-[(8S)-8-(furan-2-yl)-11-(4-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-sulfamoylphenyl)acetamide |
| SMILES | COc1ccc(N2C(=O)C3Sc4c(sc(=O)n4CC(=O)Nc4ccc(S(N)(=O)=O)cc4)[C@H](c4ccco4)C3C2=O)cc1 |
| InChI | InChI=1S/C27H22N4O8S3/c1-38-16-8-6-15(7-9-16)31-24(33)21-20(18-3-2-12-39-18)23-26(40-22(21)25(31)34)30(27(35)41-23)13-19(32)29-14-4-10-17(11-5-14)42(28,36)37/h2-12,20-22H,13H2,1H3,(H,29,32)(H2,28,36,37)/t20-,21?,22?/m1/s1 |
| InChIKey | KDOQWQOAJAMXAT-ITAUSPCMSA-N |
| XLogP | 2.59 |
| TPSA | 171.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.69 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|