C29H24N4O9S3 — CID 19248120
ethyl 4-[(1R,8R,9R)-8-(furan-2-yl)-5,10,12-trioxo-4-[2-oxo-2-(4-sulfamoylanilino)ethyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate (PubChem CID 19248120) has the molecular formula C29H24N4O9S3 and a molecular weight of 668.73 g/mol. Its IUPAC name is ethyl 4-[(1R,8R,9R)-8-(furan-2-yl)-5,10,12-trioxo-4-[2-oxo-2-(4-sulfamoylanilino)ethyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate.
| Compound Name | ethyl 4-[(1R,8R,9R)-8-(furan-2-yl)-5,10,12-trioxo-4-[2-oxo-2-(4-sulfamoylanilino)ethyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate |
|---|---|
| PubChem CID | 19248120 |
| Molecular Formula | C29H24N4O9S3 |
| Molecular Weight | 668.73 g/mol |
| Exact Mass | 668.07 |
| IUPAC Name | ethyl 4-[(1R,8R,9R)-8-(furan-2-yl)-5,10,12-trioxo-4-[2-oxo-2-(4-sulfamoylanilino)ethyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)[C@H]3[C@H](c4ccco4)c4sc(=O)n(CC(=O)Nc5ccc(S(N)(=O)=O)cc5)c4S[C@H]3C2=O)cc1 |
| InChI | InChI=1S/C29H24N4O9S3/c1-2-41-28(37)15-5-9-17(10-6-15)33-25(35)22-21(19-4-3-13-42-19)24-27(43-23(22)26(33)36)32(29(38)44-24)14-20(34)31-16-7-11-18(12-8-16)45(30,39)40/h3-13,21-23H,2,14H2,1H3,(H,31,34)(H2,30,39,40)/t21-,22-,23+/m0/s1 |
| InChIKey | PGVYFJHJKHLMTC-RJGXRXQPSA-N |
| XLogP | 2.76 |
| TPSA | 188.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.73 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|