C29H23N3O8S2 — CID 16635091
ethyl 4-[(8S)-8-(furan-2-yl)-4-[2-(4-hydroxyanilino)-2-oxoethyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate (PubChem CID 16635091) has the molecular formula C29H23N3O8S2 and a molecular weight of 605.65 g/mol. Its IUPAC name is ethyl 4-[(8S)-8-(furan-2-yl)-4-[2-(4-hydroxyanilino)-2-oxoethyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate.
| Compound Name | ethyl 4-[(8S)-8-(furan-2-yl)-4-[2-(4-hydroxyanilino)-2-oxoethyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate |
|---|---|
| PubChem CID | 16635091 |
| Molecular Formula | C29H23N3O8S2 |
| Molecular Weight | 605.65 g/mol |
| Exact Mass | 605.09 |
| IUPAC Name | ethyl 4-[(8S)-8-(furan-2-yl)-4-[2-(4-hydroxyanilino)-2-oxoethyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)C3Sc4c(sc(=O)n4CC(=O)Nc4ccc(O)cc4)[C@H](c4ccco4)C3C2=O)cc1 |
| InChI | InChI=1S/C29H23N3O8S2/c1-2-39-28(37)15-5-9-17(10-6-15)32-25(35)22-21(19-4-3-13-40-19)24-27(41-23(22)26(32)36)31(29(38)42-24)14-20(34)30-16-7-11-18(33)12-8-16/h3-13,21-23,33H,2,14H2,1H3,(H,30,34)/t21-,22?,23?/m1/s1 |
| InChIKey | BVWYWBJWEZUHEI-DDRJZQQSSA-N |
| XLogP | 3.82 |
| TPSA | 148.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.65 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|