C26H19N3O6S2 — CID 16635881
2-[(8S)-8-(furan-2-yl)-5,10,12-trioxo-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-hydroxyphenyl)acetamide (PubChem CID 16635881) has the molecular formula C26H19N3O6S2 and a molecular weight of 533.59 g/mol. Its IUPAC name is 2-[(8S)-8-(furan-2-yl)-5,10,12-trioxo-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-hydroxyphenyl)acetamide.
| Compound Name | 2-[(8S)-8-(furan-2-yl)-5,10,12-trioxo-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 16635881 |
| Molecular Formula | C26H19N3O6S2 |
| Molecular Weight | 533.59 g/mol |
| Exact Mass | 533.07 |
| IUPAC Name | 2-[(8S)-8-(furan-2-yl)-5,10,12-trioxo-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-hydroxyphenyl)acetamide |
| SMILES | O=C(Cn1c2c(sc1=O)[C@H](c1ccco1)C1C(=O)N(c3ccccc3)C(=O)C1S2)Nc1ccc(O)cc1 |
| InChI | InChI=1S/C26H19N3O6S2/c30-16-10-8-14(9-11-16)27-18(31)13-28-25-22(37-26(28)34)19(17-7-4-12-35-17)20-21(36-25)24(33)29(23(20)32)15-5-2-1-3-6-15/h1-12,19-21,30H,13H2,(H,27,31)/t19-,20?,21?/m1/s1 |
| InChIKey | NEDGIEUJXFQMNH-QNGMFEMESA-N |
| XLogP | 3.64 |
| TPSA | 121.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.59 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|