C26H18FN3O5S2 — CID 19249155
N-(4-fluorophenyl)-2-[(1R,8R,9R)-8-(furan-2-yl)-5,10,12-trioxo-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide (PubChem CID 19249155) has the molecular formula C26H18FN3O5S2 and a molecular weight of 535.58 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[(1R,8R,9R)-8-(furan-2-yl)-5,10,12-trioxo-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide.
| Compound Name | N-(4-fluorophenyl)-2-[(1R,8R,9R)-8-(furan-2-yl)-5,10,12-trioxo-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide |
|---|---|
| PubChem CID | 19249155 |
| Molecular Formula | C26H18FN3O5S2 |
| Molecular Weight | 535.58 g/mol |
| Exact Mass | 535.07 |
| IUPAC Name | N-(4-fluorophenyl)-2-[(1R,8R,9R)-8-(furan-2-yl)-5,10,12-trioxo-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide |
| SMILES | O=C(Cn1c2c(sc1=O)[C@@H](c1ccco1)[C@@H]1C(=O)N(c3ccccc3)C(=O)[C@@H]1S2)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C26H18FN3O5S2/c27-14-8-10-15(11-9-14)28-18(31)13-29-25-22(37-26(29)34)19(17-7-4-12-35-17)20-21(36-25)24(33)30(23(20)32)16-5-2-1-3-6-16/h1-12,19-21H,13H2,(H,28,31)/t19-,20-,21+/m0/s1 |
| InChIKey | ZVGLBUBHLMVDPN-PCCBWWKXSA-N |
| XLogP | 4.08 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.58 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|