C29H22FN3O7S2 — CID 16635019
ethyl 4-[(8S)-4-[2-(4-fluoroanilino)-2-oxoethyl]-8-(furan-2-yl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate (PubChem CID 16635019) has the molecular formula C29H22FN3O7S2 and a molecular weight of 607.64 g/mol. Its IUPAC name is ethyl 4-[(8S)-4-[2-(4-fluoroanilino)-2-oxoethyl]-8-(furan-2-yl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate.
| Compound Name | ethyl 4-[(8S)-4-[2-(4-fluoroanilino)-2-oxoethyl]-8-(furan-2-yl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate |
|---|---|
| PubChem CID | 16635019 |
| Molecular Formula | C29H22FN3O7S2 |
| Molecular Weight | 607.64 g/mol |
| Exact Mass | 607.09 |
| IUPAC Name | ethyl 4-[(8S)-4-[2-(4-fluoroanilino)-2-oxoethyl]-8-(furan-2-yl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)C3Sc4c(sc(=O)n4CC(=O)Nc4ccc(F)cc4)[C@H](c4ccco4)C3C2=O)cc1 |
| InChI | InChI=1S/C29H22FN3O7S2/c1-2-39-28(37)15-5-11-18(12-6-15)33-25(35)22-21(19-4-3-13-40-19)24-27(41-23(22)26(33)36)32(29(38)42-24)14-20(34)31-17-9-7-16(30)8-10-17/h3-13,21-23H,2,14H2,1H3,(H,31,34)/t21-,22?,23?/m1/s1 |
| InChIKey | FRCRDNNZNVPECW-DDRJZQQSSA-N |
| XLogP | 4.25 |
| TPSA | 127.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.64 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|