C25H23N3O5S2 — CID 16635821
(8S)-8-(furan-2-yl)-4-(2-oxo-2-piperidin-1-ylethyl)-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione (PubChem CID 16635821) has the molecular formula C25H23N3O5S2 and a molecular weight of 509.61 g/mol. Its IUPAC name is (8S)-8-(furan-2-yl)-4-(2-oxo-2-piperidin-1-ylethyl)-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione.
| Compound Name | (8S)-8-(furan-2-yl)-4-(2-oxo-2-piperidin-1-ylethyl)-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
|---|---|
| PubChem CID | 16635821 |
| Molecular Formula | C25H23N3O5S2 |
| Molecular Weight | 509.61 g/mol |
| Exact Mass | 509.11 |
| IUPAC Name | (8S)-8-(furan-2-yl)-4-(2-oxo-2-piperidin-1-ylethyl)-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
| SMILES | O=C(Cn1c2c(sc1=O)[C@H](c1ccco1)C1C(=O)N(c3ccccc3)C(=O)C1S2)N1CCCCC1 |
| InChI | InChI=1S/C25H23N3O5S2/c29-17(26-11-5-2-6-12-26)14-27-24-21(35-25(27)32)18(16-10-7-13-33-16)19-20(34-24)23(31)28(22(19)30)15-8-3-1-4-9-15/h1,3-4,7-10,13,18-20H,2,5-6,11-12,14H2/t18-,19?,20?/m1/s1 |
| InChIKey | XKXILGHHOWCXBH-XEVCZEQESA-N |
| XLogP | 3.31 |
| TPSA | 92.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.61 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|