C24H20FN3O6S2 — CID 19249770
(1R,8R,9R)-11-(4-fluorophenyl)-8-(furan-2-yl)-4-(2-morpholin-4-yl-2-oxoethyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione (PubChem CID 19249770) has the molecular formula C24H20FN3O6S2 and a molecular weight of 529.57 g/mol. Its IUPAC name is (1R,8R,9R)-11-(4-fluorophenyl)-8-(furan-2-yl)-4-(2-morpholin-4-yl-2-oxoethyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione.
| Compound Name | (1R,8R,9R)-11-(4-fluorophenyl)-8-(furan-2-yl)-4-(2-morpholin-4-yl-2-oxoethyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
|---|---|
| PubChem CID | 19249770 |
| Molecular Formula | C24H20FN3O6S2 |
| Molecular Weight | 529.57 g/mol |
| Exact Mass | 529.08 |
| IUPAC Name | (1R,8R,9R)-11-(4-fluorophenyl)-8-(furan-2-yl)-4-(2-morpholin-4-yl-2-oxoethyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
| SMILES | O=C(Cn1c2c(sc1=O)[C@@H](c1ccco1)[C@@H]1C(=O)N(c3ccc(F)cc3)C(=O)[C@@H]1S2)N1CCOCC1 |
| InChI | InChI=1S/C24H20FN3O6S2/c25-13-3-5-14(6-4-13)28-21(30)18-17(15-2-1-9-34-15)20-23(35-19(18)22(28)31)27(24(32)36-20)12-16(29)26-7-10-33-11-8-26/h1-6,9,17-19H,7-8,10-12H2/t17-,18-,19+/m0/s1 |
| InChIKey | YWNZICVNOSCYFP-GBESFXJTSA-N |
| XLogP | 2.30 |
| TPSA | 102.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.57 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|