C27H25N3O5S2 — CID 19247328
(1R,8R,9R)-11-(4-methylphenyl)-4-(2-morpholin-4-yl-2-oxoethyl)-8-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione (PubChem CID 19247328) has the molecular formula C27H25N3O5S2 and a molecular weight of 535.65 g/mol. Its IUPAC name is (1R,8R,9R)-11-(4-methylphenyl)-4-(2-morpholin-4-yl-2-oxoethyl)-8-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione.
| Compound Name | (1R,8R,9R)-11-(4-methylphenyl)-4-(2-morpholin-4-yl-2-oxoethyl)-8-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
|---|---|
| PubChem CID | 19247328 |
| Molecular Formula | C27H25N3O5S2 |
| Molecular Weight | 535.65 g/mol |
| Exact Mass | 535.12 |
| IUPAC Name | (1R,8R,9R)-11-(4-methylphenyl)-4-(2-morpholin-4-yl-2-oxoethyl)-8-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
| SMILES | Cc1ccc(N2C(=O)[C@H]3[C@H](c4ccccc4)c4sc(=O)n(CC(=O)N5CCOCC5)c4S[C@H]3C2=O)cc1 |
| InChI | InChI=1S/C27H25N3O5S2/c1-16-7-9-18(10-8-16)30-24(32)21-20(17-5-3-2-4-6-17)23-26(36-22(21)25(30)33)29(27(34)37-23)15-19(31)28-11-13-35-14-12-28/h2-10,20-22H,11-15H2,1H3/t20-,21-,22+/m0/s1 |
| InChIKey | GAHPMLSXDWSRJN-FDFHNCONSA-N |
| XLogP | 2.87 |
| TPSA | 88.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.65 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|