C28H27N3O6S2 — CID 19247338
(1R,8R,9R)-8-(2-methoxyphenyl)-11-(4-methylphenyl)-4-(2-morpholin-4-yl-2-oxoethyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione (PubChem CID 19247338) has the molecular formula C28H27N3O6S2 and a molecular weight of 565.67 g/mol. Its IUPAC name is (1R,8R,9R)-8-(2-methoxyphenyl)-11-(4-methylphenyl)-4-(2-morpholin-4-yl-2-oxoethyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione.
| Compound Name | (1R,8R,9R)-8-(2-methoxyphenyl)-11-(4-methylphenyl)-4-(2-morpholin-4-yl-2-oxoethyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
|---|---|
| PubChem CID | 19247338 |
| Molecular Formula | C28H27N3O6S2 |
| Molecular Weight | 565.67 g/mol |
| Exact Mass | 565.13 |
| IUPAC Name | (1R,8R,9R)-8-(2-methoxyphenyl)-11-(4-methylphenyl)-4-(2-morpholin-4-yl-2-oxoethyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
| SMILES | COc1ccccc1[C@@H]1c2sc(=O)n(CC(=O)N3CCOCC3)c2S[C@H]2C(=O)N(c3ccc(C)cc3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C28H27N3O6S2/c1-16-7-9-17(10-8-16)31-25(33)22-21(18-5-3-4-6-19(18)36-2)24-27(38-23(22)26(31)34)30(28(35)39-24)15-20(32)29-11-13-37-14-12-29/h3-10,21-23H,11-15H2,1-2H3/t21-,22-,23+/m0/s1 |
| InChIKey | FCXULBKGYSDDNP-RJGXRXQPSA-N |
| XLogP | 2.88 |
| TPSA | 98.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.67 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|