C29H27N3O8S2 — CID 18862495
ethyl 4-[(1S,8R,9S)-8-(2-hydroxyphenyl)-4-(2-morpholin-4-yl-2-oxoethyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate (PubChem CID 18862495) has the molecular formula C29H27N3O8S2 and a molecular weight of 609.68 g/mol. Its IUPAC name is ethyl 4-[(1S,8R,9S)-8-(2-hydroxyphenyl)-4-(2-morpholin-4-yl-2-oxoethyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate.
| Compound Name | ethyl 4-[(1S,8R,9S)-8-(2-hydroxyphenyl)-4-(2-morpholin-4-yl-2-oxoethyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate |
|---|---|
| PubChem CID | 18862495 |
| Molecular Formula | C29H27N3O8S2 |
| Molecular Weight | 609.68 g/mol |
| Exact Mass | 609.12 |
| IUPAC Name | ethyl 4-[(1S,8R,9S)-8-(2-hydroxyphenyl)-4-(2-morpholin-4-yl-2-oxoethyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)[C@@H]3[C@H](c4ccccc4O)c4sc(=O)n(CC(=O)N5CCOCC5)c4S[C@@H]3C2=O)cc1 |
| InChI | InChI=1S/C29H27N3O8S2/c1-2-40-28(37)16-7-9-17(10-8-16)32-25(35)22-21(18-5-3-4-6-19(18)33)24-27(41-23(22)26(32)36)31(29(38)42-24)15-20(34)30-11-13-39-14-12-30/h3-10,21-23,33H,2,11-15H2,1H3/t21-,22+,23-/m0/s1 |
| InChIKey | KRKITDGCEJVIFX-ZRBLBEILSA-N |
| XLogP | 2.45 |
| TPSA | 135.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.68 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|