C30H29N3O9S2 — CID 21227574
ethyl 4-[8-(4-hydroxy-3-methoxyphenyl)-4-(2-morpholin-4-yl-2-oxoethyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate (PubChem CID 21227574) has the molecular formula C30H29N3O9S2 and a molecular weight of 639.71 g/mol. Its IUPAC name is ethyl 4-[8-(4-hydroxy-3-methoxyphenyl)-4-(2-morpholin-4-yl-2-oxoethyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate.
| Compound Name | ethyl 4-[8-(4-hydroxy-3-methoxyphenyl)-4-(2-morpholin-4-yl-2-oxoethyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate |
|---|---|
| PubChem CID | 21227574 |
| Molecular Formula | C30H29N3O9S2 |
| Molecular Weight | 639.71 g/mol |
| Exact Mass | 639.13 |
| IUPAC Name | ethyl 4-[8-(4-hydroxy-3-methoxyphenyl)-4-(2-morpholin-4-yl-2-oxoethyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)C3Sc4c(sc(=O)n4CC(=O)N4CCOCC4)C(c4ccc(O)c(OC)c4)C3C2=O)cc1 |
| InChI | InChI=1S/C30H29N3O9S2/c1-3-42-29(38)16-4-7-18(8-5-16)33-26(36)23-22(17-6-9-19(34)20(14-17)40-2)25-28(43-24(23)27(33)37)32(30(39)44-25)15-21(35)31-10-12-41-13-11-31/h4-9,14,22-24,34H,3,10-13,15H2,1-2H3 |
| InChIKey | DPYRKUVDGCUMET-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 144.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.71 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|