C27H24BrN3O7S2 — CID 43845968
(8R)-11-(4-bromophenyl)-8-(4-hydroxy-3-methoxyphenyl)-4-(2-morpholin-4-yl-2-oxoethyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione (PubChem CID 43845968) has the molecular formula C27H24BrN3O7S2 and a molecular weight of 646.54 g/mol. Its IUPAC name is (8R)-11-(4-bromophenyl)-8-(4-hydroxy-3-methoxyphenyl)-4-(2-morpholin-4-yl-2-oxoethyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione.
| Compound Name | (8R)-11-(4-bromophenyl)-8-(4-hydroxy-3-methoxyphenyl)-4-(2-morpholin-4-yl-2-oxoethyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
|---|---|
| PubChem CID | 43845968 |
| Molecular Formula | C27H24BrN3O7S2 |
| Molecular Weight | 646.54 g/mol |
| Exact Mass | 645.02 |
| IUPAC Name | (8R)-11-(4-bromophenyl)-8-(4-hydroxy-3-methoxyphenyl)-4-(2-morpholin-4-yl-2-oxoethyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
| SMILES | COc1cc([C@@H]2c3sc(=O)n(CC(=O)N4CCOCC4)c3SC3C(=O)N(c4ccc(Br)cc4)C(=O)C32)ccc1O |
| InChI | InChI=1S/C27H24BrN3O7S2/c1-37-18-12-14(2-7-17(18)32)20-21-22(25(35)31(24(21)34)16-5-3-15(28)4-6-16)39-26-23(20)40-27(36)30(26)13-19(33)29-8-10-38-11-9-29/h2-7,12,20-22,32H,8-11,13H2,1H3/t20-,21?,22?/m0/s1 |
| InChIKey | UQWBRKDSHKJLCA-HWELCPFYSA-N |
| XLogP | 3.04 |
| TPSA | 118.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.54 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|