C31H31N3O8S2 — CID 43846196
ethyl 4-[(8R)-8-(4-hydroxy-3-methoxyphenyl)-5,10,12-trioxo-4-(2-oxo-2-piperidin-1-ylethyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate (PubChem CID 43846196) has the molecular formula C31H31N3O8S2 and a molecular weight of 637.74 g/mol. Its IUPAC name is ethyl 4-[(8R)-8-(4-hydroxy-3-methoxyphenyl)-5,10,12-trioxo-4-(2-oxo-2-piperidin-1-ylethyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate.
| Compound Name | ethyl 4-[(8R)-8-(4-hydroxy-3-methoxyphenyl)-5,10,12-trioxo-4-(2-oxo-2-piperidin-1-ylethyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate |
|---|---|
| PubChem CID | 43846196 |
| Molecular Formula | C31H31N3O8S2 |
| Molecular Weight | 637.74 g/mol |
| Exact Mass | 637.16 |
| IUPAC Name | ethyl 4-[(8R)-8-(4-hydroxy-3-methoxyphenyl)-5,10,12-trioxo-4-(2-oxo-2-piperidin-1-ylethyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)C3Sc4c(sc(=O)n4CC(=O)N4CCCCC4)[C@@H](c4ccc(O)c(OC)c4)C3C2=O)cc1 |
| InChI | InChI=1S/C31H31N3O8S2/c1-3-42-30(39)17-7-10-19(11-8-17)34-27(37)24-23(18-9-12-20(35)21(15-18)41-2)26-29(43-25(24)28(34)38)33(31(40)44-26)16-22(36)32-13-5-4-6-14-32/h7-12,15,23-25,35H,3-6,13-14,16H2,1-2H3/t23-,24?,25?/m0/s1 |
| InChIKey | PFEJNYYDKLVTLH-KAVZGVEFSA-N |
| XLogP | 3.61 |
| TPSA | 135.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.74 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|