C32H33N3O8S2 — CID 21227572
ethyl 4-[8-(3-ethoxy-4-hydroxyphenyl)-5,10,12-trioxo-4-(2-oxo-2-piperidin-1-ylethyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate (PubChem CID 21227572) has the molecular formula C32H33N3O8S2 and a molecular weight of 651.76 g/mol. Its IUPAC name is ethyl 4-[8-(3-ethoxy-4-hydroxyphenyl)-5,10,12-trioxo-4-(2-oxo-2-piperidin-1-ylethyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate.
| Compound Name | ethyl 4-[8-(3-ethoxy-4-hydroxyphenyl)-5,10,12-trioxo-4-(2-oxo-2-piperidin-1-ylethyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate |
|---|---|
| PubChem CID | 21227572 |
| Molecular Formula | C32H33N3O8S2 |
| Molecular Weight | 651.76 g/mol |
| Exact Mass | 651.17 |
| IUPAC Name | ethyl 4-[8-(3-ethoxy-4-hydroxyphenyl)-5,10,12-trioxo-4-(2-oxo-2-piperidin-1-ylethyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)C3Sc4c(sc(=O)n4CC(=O)N4CCCCC4)C(c4ccc(O)c(OCC)c4)C3C2=O)cc1 |
| InChI | InChI=1S/C32H33N3O8S2/c1-3-42-22-16-19(10-13-21(22)36)24-25-26(29(39)35(28(25)38)20-11-8-18(9-12-20)31(40)43-4-2)44-30-27(24)45-32(41)34(30)17-23(37)33-14-6-5-7-15-33/h8-13,16,24-26,36H,3-7,14-15,17H2,1-2H3 |
| InChIKey | UVCLCCRXABDXLU-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 135.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.76 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|