C30H28BrN3O6S2 — CID 16635046
ethyl 4-[(8S)-8-(3-bromophenyl)-5,10,12-trioxo-4-(2-oxo-2-piperidin-1-ylethyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate (PubChem CID 16635046) has the molecular formula C30H28BrN3O6S2 and a molecular weight of 670.61 g/mol. Its IUPAC name is ethyl 4-[(8S)-8-(3-bromophenyl)-5,10,12-trioxo-4-(2-oxo-2-piperidin-1-ylethyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate.
| Compound Name | ethyl 4-[(8S)-8-(3-bromophenyl)-5,10,12-trioxo-4-(2-oxo-2-piperidin-1-ylethyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate |
|---|---|
| PubChem CID | 16635046 |
| Molecular Formula | C30H28BrN3O6S2 |
| Molecular Weight | 670.61 g/mol |
| Exact Mass | 669.06 |
| IUPAC Name | ethyl 4-[(8S)-8-(3-bromophenyl)-5,10,12-trioxo-4-(2-oxo-2-piperidin-1-ylethyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)C3Sc4c(sc(=O)n4CC(=O)N4CCCCC4)[C@H](c4cccc(Br)c4)C3C2=O)cc1 |
| InChI | InChI=1S/C30H28BrN3O6S2/c1-2-40-29(38)17-9-11-20(12-10-17)34-26(36)23-22(18-7-6-8-19(31)15-18)25-28(41-24(23)27(34)37)33(30(39)42-25)16-21(35)32-13-4-3-5-14-32/h6-12,15,22-24H,2-5,13-14,16H2,1H3/t22-,23?,24?/m1/s1 |
| InChIKey | MGVBWNFWXIIBRU-ZKMFCFPVSA-N |
| XLogP | 4.66 |
| TPSA | 105.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.61 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|