C27H23BrN2O7S2 — CID 16635133
ethyl 4-[(8S)-8-(4-bromophenyl)-4-(2-ethoxy-2-oxoethyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate (PubChem CID 16635133) has the molecular formula C27H23BrN2O7S2 and a molecular weight of 631.53 g/mol. Its IUPAC name is ethyl 4-[(8S)-8-(4-bromophenyl)-4-(2-ethoxy-2-oxoethyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate.
| Compound Name | ethyl 4-[(8S)-8-(4-bromophenyl)-4-(2-ethoxy-2-oxoethyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate |
|---|---|
| PubChem CID | 16635133 |
| Molecular Formula | C27H23BrN2O7S2 |
| Molecular Weight | 631.53 g/mol |
| Exact Mass | 630.01 |
| IUPAC Name | ethyl 4-[(8S)-8-(4-bromophenyl)-4-(2-ethoxy-2-oxoethyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate |
| SMILES | CCOC(=O)Cn1c2c(sc1=O)[C@H](c1ccc(Br)cc1)C1C(=O)N(c3ccc(C(=O)OCC)cc3)C(=O)C1S2 |
| InChI | InChI=1S/C27H23BrN2O7S2/c1-3-36-18(31)13-29-25-22(39-27(29)35)19(14-5-9-16(28)10-6-14)20-21(38-25)24(33)30(23(20)32)17-11-7-15(8-12-17)26(34)37-4-2/h5-12,19-21H,3-4,13H2,1-2H3/t19-,20?,21?/m1/s1 |
| InChIKey | NVMHTLWAPKXJOT-QNGMFEMESA-N |
| XLogP | 4.21 |
| TPSA | 111.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.53 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|