C26H23N3O7S2 — CID 19248232
ethyl 4-[(1R,8R,9R)-4-(2-ethoxy-2-oxoethyl)-5,10,12-trioxo-8-pyridin-3-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate (PubChem CID 19248232) has the molecular formula C26H23N3O7S2 and a molecular weight of 553.62 g/mol. Its IUPAC name is ethyl 4-[(1R,8R,9R)-4-(2-ethoxy-2-oxoethyl)-5,10,12-trioxo-8-pyridin-3-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate.
| Compound Name | ethyl 4-[(1R,8R,9R)-4-(2-ethoxy-2-oxoethyl)-5,10,12-trioxo-8-pyridin-3-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate |
|---|---|
| PubChem CID | 19248232 |
| Molecular Formula | C26H23N3O7S2 |
| Molecular Weight | 553.62 g/mol |
| Exact Mass | 553.10 |
| IUPAC Name | ethyl 4-[(1R,8R,9R)-4-(2-ethoxy-2-oxoethyl)-5,10,12-trioxo-8-pyridin-3-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate |
| SMILES | CCOC(=O)Cn1c2c(sc1=O)[C@@H](c1cccnc1)[C@@H]1C(=O)N(c3ccc(C(=O)OCC)cc3)C(=O)[C@@H]1S2 |
| InChI | InChI=1S/C26H23N3O7S2/c1-3-35-17(30)13-28-24-21(38-26(28)34)18(15-6-5-11-27-12-15)19-20(37-24)23(32)29(22(19)31)16-9-7-14(8-10-16)25(33)36-4-2/h5-12,18-20H,3-4,13H2,1-2H3/t18-,19-,20+/m0/s1 |
| InChIKey | FXXPWTDKTRPVIP-SLFFLAALSA-N |
| XLogP | 2.84 |
| TPSA | 124.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.62 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|