C25H21ClN2O5S2 — CID 16634559
ethyl 2-[(8S)-8-(4-chlorophenyl)-11-(4-methylphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetate (PubChem CID 16634559) has the molecular formula C25H21ClN2O5S2 and a molecular weight of 529.04 g/mol. Its IUPAC name is ethyl 2-[(8S)-8-(4-chlorophenyl)-11-(4-methylphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetate.
| Compound Name | ethyl 2-[(8S)-8-(4-chlorophenyl)-11-(4-methylphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetate |
|---|---|
| PubChem CID | 16634559 |
| Molecular Formula | C25H21ClN2O5S2 |
| Molecular Weight | 529.04 g/mol |
| Exact Mass | 528.06 |
| IUPAC Name | ethyl 2-[(8S)-8-(4-chlorophenyl)-11-(4-methylphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetate |
| SMILES | CCOC(=O)Cn1c2c(sc1=O)[C@H](c1ccc(Cl)cc1)C1C(=O)N(c3ccc(C)cc3)C(=O)C1S2 |
| InChI | InChI=1S/C25H21ClN2O5S2/c1-3-33-17(29)12-27-24-21(35-25(27)32)18(14-6-8-15(26)9-7-14)19-20(34-24)23(31)28(22(19)30)16-10-4-13(2)5-11-16/h4-11,18-20H,3,12H2,1-2H3/t18-,19?,20?/m1/s1 |
| InChIKey | VXKBALBTIIUXCV-XEVCZEQESA-N |
| XLogP | 4.23 |
| TPSA | 85.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.04 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|