C25H21BrN2O6S2 — CID 19247690
ethyl 2-[(1R,8R,9R)-11-(4-bromophenyl)-8-(4-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetate (PubChem CID 19247690) has the molecular formula C25H21BrN2O6S2 and a molecular weight of 589.49 g/mol. Its IUPAC name is ethyl 2-[(1R,8R,9R)-11-(4-bromophenyl)-8-(4-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetate.
| Compound Name | ethyl 2-[(1R,8R,9R)-11-(4-bromophenyl)-8-(4-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetate |
|---|---|
| PubChem CID | 19247690 |
| Molecular Formula | C25H21BrN2O6S2 |
| Molecular Weight | 589.49 g/mol |
| Exact Mass | 588.00 |
| IUPAC Name | ethyl 2-[(1R,8R,9R)-11-(4-bromophenyl)-8-(4-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetate |
| SMILES | CCOC(=O)Cn1c2c(sc1=O)[C@@H](c1ccc(OC)cc1)[C@@H]1C(=O)N(c3ccc(Br)cc3)C(=O)[C@@H]1S2 |
| InChI | InChI=1S/C25H21BrN2O6S2/c1-3-34-17(29)12-27-24-21(36-25(27)32)18(13-4-10-16(33-2)11-5-13)19-20(35-24)23(31)28(22(19)30)15-8-6-14(26)7-9-15/h4-11,18-20H,3,12H2,1-2H3/t18-,19-,20+/m0/s1 |
| InChIKey | CMVUEDMYNLTKQQ-SLFFLAALSA-N |
| XLogP | 4.04 |
| TPSA | 94.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.49 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|