C23H20N2O6S3 — CID 43848089
ethyl 2-[11-(4-methoxyphenyl)-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetate (PubChem CID 43848089) has the molecular formula C23H20N2O6S3 and a molecular weight of 516.62 g/mol. Its IUPAC name is ethyl 2-[11-(4-methoxyphenyl)-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetate.
| Compound Name | ethyl 2-[11-(4-methoxyphenyl)-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetate |
|---|---|
| PubChem CID | 43848089 |
| Molecular Formula | C23H20N2O6S3 |
| Molecular Weight | 516.62 g/mol |
| Exact Mass | 516.05 |
| IUPAC Name | ethyl 2-[11-(4-methoxyphenyl)-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetate |
| SMILES | CCOC(=O)Cn1c2c(sc1=O)C(c1cccs1)C1C(=O)N(c3ccc(OC)cc3)C(=O)C1S2 |
| InChI | InChI=1S/C23H20N2O6S3/c1-3-31-15(26)11-24-22-19(34-23(24)29)16(14-5-4-10-32-14)17-18(33-22)21(28)25(20(17)27)12-6-8-13(30-2)9-7-12/h4-10,16-18H,3,11H2,1-2H3 |
| InChIKey | MXOWHUZWIUSQQR-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 94.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.62 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|