C27H19Cl2N3O5S3 — CID 19249090
N-(3,4-dichlorophenyl)-2-[(1R,8R,9R)-11-(4-methoxyphenyl)-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide (PubChem CID 19249090) has the molecular formula C27H19Cl2N3O5S3 and a molecular weight of 632.57 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-2-[(1R,8R,9R)-11-(4-methoxyphenyl)-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide.
| Compound Name | N-(3,4-dichlorophenyl)-2-[(1R,8R,9R)-11-(4-methoxyphenyl)-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide |
|---|---|
| PubChem CID | 19249090 |
| Molecular Formula | C27H19Cl2N3O5S3 |
| Molecular Weight | 632.57 g/mol |
| Exact Mass | 630.99 |
| IUPAC Name | N-(3,4-dichlorophenyl)-2-[(1R,8R,9R)-11-(4-methoxyphenyl)-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide |
| SMILES | COc1ccc(N2C(=O)[C@H]3[C@H](c4cccs4)c4sc(=O)n(CC(=O)Nc5ccc(Cl)c(Cl)c5)c4S[C@H]3C2=O)cc1 |
| InChI | InChI=1S/C27H19Cl2N3O5S3/c1-37-15-7-5-14(6-8-15)32-24(34)21-20(18-3-2-10-38-18)23-26(39-22(21)25(32)35)31(27(36)40-23)12-19(33)30-13-4-9-16(28)17(29)11-13/h2-11,20-22H,12H2,1H3,(H,30,33)/t20-,21-,22+/m0/s1 |
| InChIKey | PAQXFBRVJPDJTC-FDFHNCONSA-N |
| XLogP | 5.72 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.57 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|