C26H16Cl2FN3O4S3 — CID 19249900
N-(3,4-dichlorophenyl)-2-[(1R,8R,9R)-11-(4-fluorophenyl)-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide (PubChem CID 19249900) has the molecular formula C26H16Cl2FN3O4S3 and a molecular weight of 620.54 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-2-[(1R,8R,9R)-11-(4-fluorophenyl)-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide.
| Compound Name | N-(3,4-dichlorophenyl)-2-[(1R,8R,9R)-11-(4-fluorophenyl)-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide |
|---|---|
| PubChem CID | 19249900 |
| Molecular Formula | C26H16Cl2FN3O4S3 |
| Molecular Weight | 620.54 g/mol |
| Exact Mass | 618.97 |
| IUPAC Name | N-(3,4-dichlorophenyl)-2-[(1R,8R,9R)-11-(4-fluorophenyl)-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide |
| SMILES | O=C(Cn1c2c(sc1=O)[C@@H](c1cccs1)[C@@H]1C(=O)N(c3ccc(F)cc3)C(=O)[C@@H]1S2)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C26H16Cl2FN3O4S3/c27-15-8-5-13(10-16(15)28)30-18(33)11-31-25-22(39-26(31)36)19(17-2-1-9-37-17)20-21(38-25)24(35)32(23(20)34)14-6-3-12(29)4-7-14/h1-10,19-21H,11H2,(H,30,33)/t19-,20-,21+/m0/s1 |
| InChIKey | RJZGMSRKVCUKEE-PCCBWWKXSA-N |
| XLogP | 5.85 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.54 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|