C26H17FN4O6S3 — CID 18862554
N-(4-fluorophenyl)-2-[(1S,8R,9S)-11-(4-nitrophenyl)-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide (PubChem CID 18862554) has the molecular formula C26H17FN4O6S3 and a molecular weight of 596.64 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[(1S,8R,9S)-11-(4-nitrophenyl)-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide.
| Compound Name | N-(4-fluorophenyl)-2-[(1S,8R,9S)-11-(4-nitrophenyl)-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide |
|---|---|
| PubChem CID | 18862554 |
| Molecular Formula | C26H17FN4O6S3 |
| Molecular Weight | 596.64 g/mol |
| Exact Mass | 596.03 |
| IUPAC Name | N-(4-fluorophenyl)-2-[(1S,8R,9S)-11-(4-nitrophenyl)-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide |
| SMILES | O=C(Cn1c2c(sc1=O)[C@@H](c1cccs1)[C@H]1C(=O)N(c3ccc([N+](=O)[O-])cc3)C(=O)[C@H]1S2)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C26H17FN4O6S3/c27-13-3-5-14(6-4-13)28-18(32)12-29-25-22(40-26(29)35)19(17-2-1-11-38-17)20-21(39-25)24(34)30(23(20)33)15-7-9-16(10-8-15)31(36)37/h1-11,19-21H,12H2,(H,28,32)/t19-,20+,21-/m0/s1 |
| InChIKey | JUBNPDBGXPERJK-HBMCJLEFSA-N |
| XLogP | 4.45 |
| TPSA | 131.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.64 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|