C27H20FN3O4S3 — CID 19249840
2-[(1R,8R,9R)-11-(4-fluorophenyl)-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(2-methylphenyl)acetamide (PubChem CID 19249840) has the molecular formula C27H20FN3O4S3 and a molecular weight of 565.67 g/mol. Its IUPAC name is 2-[(1R,8R,9R)-11-(4-fluorophenyl)-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(2-methylphenyl)acetamide.
| Compound Name | 2-[(1R,8R,9R)-11-(4-fluorophenyl)-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 19249840 |
| Molecular Formula | C27H20FN3O4S3 |
| Molecular Weight | 565.67 g/mol |
| Exact Mass | 565.06 |
| IUPAC Name | 2-[(1R,8R,9R)-11-(4-fluorophenyl)-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(2-methylphenyl)acetamide |
| SMILES | Cc1ccccc1NC(=O)Cn1c2c(sc1=O)[C@@H](c1cccs1)[C@@H]1C(=O)N(c3ccc(F)cc3)C(=O)[C@@H]1S2 |
| InChI | InChI=1S/C27H20FN3O4S3/c1-14-5-2-3-6-17(14)29-19(32)13-30-26-23(38-27(30)35)20(18-7-4-12-36-18)21-22(37-26)25(34)31(24(21)33)16-10-8-15(28)9-11-16/h2-12,20-22H,13H2,1H3,(H,29,32)/t20-,21-,22+/m0/s1 |
| InChIKey | GHUHCECKMCNQPV-FDFHNCONSA-N |
| XLogP | 4.85 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.67 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|