C26H17F2N3O4S3 — CID 16636296
N-(4-fluorophenyl)-2-[(8S)-11-(4-fluorophenyl)-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide (PubChem CID 16636296) has the molecular formula C26H17F2N3O4S3 and a molecular weight of 569.64 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[(8S)-11-(4-fluorophenyl)-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide.
| Compound Name | N-(4-fluorophenyl)-2-[(8S)-11-(4-fluorophenyl)-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide |
|---|---|
| PubChem CID | 16636296 |
| Molecular Formula | C26H17F2N3O4S3 |
| Molecular Weight | 569.64 g/mol |
| Exact Mass | 569.03 |
| IUPAC Name | N-(4-fluorophenyl)-2-[(8S)-11-(4-fluorophenyl)-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide |
| SMILES | O=C(Cn1c2c(sc1=O)[C@H](c1cccs1)C1C(=O)N(c3ccc(F)cc3)C(=O)C1S2)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C26H17F2N3O4S3/c27-13-3-7-15(8-4-13)29-18(32)12-30-25-22(38-26(30)35)19(17-2-1-11-36-17)20-21(37-25)24(34)31(23(20)33)16-9-5-14(28)6-10-16/h1-11,19-21H,12H2,(H,29,32)/t19-,20?,21?/m1/s1 |
| InChIKey | NABFPOUANUCOGT-QNGMFEMESA-N |
| XLogP | 4.68 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.64 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|