C26H18ClN3O5S3 — CID 16634896
2-[(8S)-11-(4-chlorophenyl)-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-hydroxyphenyl)acetamide (PubChem CID 16634896) has the molecular formula C26H18ClN3O5S3 and a molecular weight of 584.10 g/mol. Its IUPAC name is 2-[(8S)-11-(4-chlorophenyl)-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-hydroxyphenyl)acetamide.
| Compound Name | 2-[(8S)-11-(4-chlorophenyl)-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 16634896 |
| Molecular Formula | C26H18ClN3O5S3 |
| Molecular Weight | 584.10 g/mol |
| Exact Mass | 583.01 |
| IUPAC Name | 2-[(8S)-11-(4-chlorophenyl)-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-hydroxyphenyl)acetamide |
| SMILES | O=C(Cn1c2c(sc1=O)[C@H](c1cccs1)C1C(=O)N(c3ccc(Cl)cc3)C(=O)C1S2)Nc1ccc(O)cc1 |
| InChI | InChI=1S/C26H18ClN3O5S3/c27-13-3-7-15(8-4-13)30-23(33)20-19(17-2-1-11-36-17)22-25(37-21(20)24(30)34)29(26(35)38-22)12-18(32)28-14-5-9-16(31)10-6-14/h1-11,19-21,31H,12H2,(H,28,32)/t19-,20?,21?/m1/s1 |
| InChIKey | WDHDNVVNDOFSFE-QNGMFEMESA-N |
| XLogP | 4.76 |
| TPSA | 108.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.10 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|