C27H21N3O4S3 — CID 18862038
2-[(1S,8R,9S)-11-(4-methylphenyl)-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-phenylacetamide (PubChem CID 18862038) has the molecular formula C27H21N3O4S3 and a molecular weight of 547.68 g/mol. Its IUPAC name is 2-[(1S,8R,9S)-11-(4-methylphenyl)-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-phenylacetamide.
| Compound Name | 2-[(1S,8R,9S)-11-(4-methylphenyl)-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 18862038 |
| Molecular Formula | C27H21N3O4S3 |
| Molecular Weight | 547.68 g/mol |
| Exact Mass | 547.07 |
| IUPAC Name | 2-[(1S,8R,9S)-11-(4-methylphenyl)-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-phenylacetamide |
| SMILES | Cc1ccc(N2C(=O)[C@@H]3[C@H](c4cccs4)c4sc(=O)n(CC(=O)Nc5ccccc5)c4S[C@@H]3C2=O)cc1 |
| InChI | InChI=1S/C27H21N3O4S3/c1-15-9-11-17(12-10-15)30-24(32)21-20(18-8-5-13-35-18)23-26(36-22(21)25(30)33)29(27(34)37-23)14-19(31)28-16-6-3-2-4-7-16/h2-13,20-22H,14H2,1H3,(H,28,31)/t20-,21+,22-/m0/s1 |
| InChIKey | MMMRNVWNLTXGKO-BDTNDASRSA-N |
| XLogP | 4.71 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.68 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|