C27H22N4O6S4 — CID 18862110
2-[(1S,8R,9S)-11-(4-methylphenyl)-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-sulfamoylphenyl)acetamide (PubChem CID 18862110) has the molecular formula C27H22N4O6S4 and a molecular weight of 626.76 g/mol. Its IUPAC name is 2-[(1S,8R,9S)-11-(4-methylphenyl)-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-sulfamoylphenyl)acetamide.
| Compound Name | 2-[(1S,8R,9S)-11-(4-methylphenyl)-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 18862110 |
| Molecular Formula | C27H22N4O6S4 |
| Molecular Weight | 626.76 g/mol |
| Exact Mass | 626.04 |
| IUPAC Name | 2-[(1S,8R,9S)-11-(4-methylphenyl)-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-sulfamoylphenyl)acetamide |
| SMILES | Cc1ccc(N2C(=O)[C@@H]3[C@H](c4cccs4)c4sc(=O)n(CC(=O)Nc5ccc(S(N)(=O)=O)cc5)c4S[C@@H]3C2=O)cc1 |
| InChI | InChI=1S/C27H22N4O6S4/c1-14-4-8-16(9-5-14)31-24(33)21-20(18-3-2-12-38-18)23-26(39-22(21)25(31)34)30(27(35)40-23)13-19(32)29-15-6-10-17(11-7-15)41(28,36)37/h2-12,20-22H,13H2,1H3,(H,29,32)(H2,28,36,37)/t20-,21+,22-/m0/s1 |
| InChIKey | VXGIIXUXYXADCL-BDTNDASRSA-N |
| XLogP | 3.36 |
| TPSA | 148.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.76 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|