C33H32N4O6S3 — CID 43845828
2-[(8R)-8-(4-tert-butylphenyl)-11-(4-methylphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-sulfamoylphenyl)acetamide (PubChem CID 43845828) has the molecular formula C33H32N4O6S3 and a molecular weight of 676.84 g/mol. Its IUPAC name is 2-[(8R)-8-(4-tert-butylphenyl)-11-(4-methylphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-sulfamoylphenyl)acetamide.
| Compound Name | 2-[(8R)-8-(4-tert-butylphenyl)-11-(4-methylphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 43845828 |
| Molecular Formula | C33H32N4O6S3 |
| Molecular Weight | 676.84 g/mol |
| Exact Mass | 676.15 |
| IUPAC Name | 2-[(8R)-8-(4-tert-butylphenyl)-11-(4-methylphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-sulfamoylphenyl)acetamide |
| SMILES | Cc1ccc(N2C(=O)C3Sc4c(sc(=O)n4CC(=O)Nc4ccc(S(N)(=O)=O)cc4)[C@@H](c4ccc(C(C)(C)C)cc4)C3C2=O)cc1 |
| InChI | InChI=1S/C33H32N4O6S3/c1-18-5-13-22(14-6-18)37-29(39)26-25(19-7-9-20(10-8-19)33(2,3)4)28-31(44-27(26)30(37)40)36(32(41)45-28)17-24(38)35-21-11-15-23(16-12-21)46(34,42)43/h5-16,25-27H,17H2,1-4H3,(H,35,38)(H2,34,42,43)/t25-,26?,27?/m0/s1 |
| InChIKey | AWKORRXSUNLLDU-JRFCFUNGSA-N |
| XLogP | 4.60 |
| TPSA | 148.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.84 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|