C31H28N4O8S3 — CID 43845827
2-[(8R)-8-(3-ethoxy-4-hydroxyphenyl)-11-(4-methylphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-sulfamoylphenyl)acetamide (PubChem CID 43845827) has the molecular formula C31H28N4O8S3 and a molecular weight of 680.79 g/mol. Its IUPAC name is 2-[(8R)-8-(3-ethoxy-4-hydroxyphenyl)-11-(4-methylphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-sulfamoylphenyl)acetamide.
| Compound Name | 2-[(8R)-8-(3-ethoxy-4-hydroxyphenyl)-11-(4-methylphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 43845827 |
| Molecular Formula | C31H28N4O8S3 |
| Molecular Weight | 680.79 g/mol |
| Exact Mass | 680.11 |
| IUPAC Name | 2-[(8R)-8-(3-ethoxy-4-hydroxyphenyl)-11-(4-methylphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-sulfamoylphenyl)acetamide |
| SMILES | CCOc1cc([C@@H]2c3sc(=O)n(CC(=O)Nc4ccc(S(N)(=O)=O)cc4)c3SC3C(=O)N(c4ccc(C)cc4)C(=O)C32)ccc1O |
| InChI | InChI=1S/C31H28N4O8S3/c1-3-43-22-14-17(6-13-21(22)36)24-25-26(29(39)35(28(25)38)19-9-4-16(2)5-10-19)44-30-27(24)45-31(40)34(30)15-23(37)33-18-7-11-20(12-8-18)46(32,41)42/h4-14,24-26,36H,3,15H2,1-2H3,(H,33,37)(H2,32,41,42)/t24-,25?,26?/m0/s1 |
| InChIKey | KZNLEAUWVOZDLH-IHSPPPAMSA-N |
| XLogP | 3.40 |
| TPSA | 178.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.79 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|