C29H23ClN4O8S3 — CID 21227529
2-[11-(4-chlorophenyl)-8-(4-hydroxy-3-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-sulfamoylphenyl)acetamide (PubChem CID 21227529) has the molecular formula C29H23ClN4O8S3 and a molecular weight of 687.18 g/mol. Its IUPAC name is 2-[11-(4-chlorophenyl)-8-(4-hydroxy-3-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-sulfamoylphenyl)acetamide.
| Compound Name | 2-[11-(4-chlorophenyl)-8-(4-hydroxy-3-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 21227529 |
| Molecular Formula | C29H23ClN4O8S3 |
| Molecular Weight | 687.18 g/mol |
| Exact Mass | 686.04 |
| IUPAC Name | 2-[11-(4-chlorophenyl)-8-(4-hydroxy-3-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-sulfamoylphenyl)acetamide |
| SMILES | COc1cc(C2c3sc(=O)n(CC(=O)Nc4ccc(S(N)(=O)=O)cc4)c3SC3C(=O)N(c4ccc(Cl)cc4)C(=O)C32)ccc1O |
| InChI | InChI=1S/C29H23ClN4O8S3/c1-42-20-12-14(2-11-19(20)35)22-23-24(27(38)34(26(23)37)17-7-3-15(30)4-8-17)43-28-25(22)44-29(39)33(28)13-21(36)32-16-5-9-18(10-6-16)45(31,40)41/h2-12,22-24,35H,13H2,1H3,(H,32,36)(H2,31,40,41) |
| InChIKey | QRKQCOWDQOEUPX-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 178.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.18 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|