C30H25FN4O8S3 — CID 19249729
2-[(1R,8R,9R)-8-(3,4-dimethoxyphenyl)-11-(4-fluorophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-sulfamoylphenyl)acetamide (PubChem CID 19249729) has the molecular formula C30H25FN4O8S3 and a molecular weight of 684.75 g/mol. Its IUPAC name is 2-[(1R,8R,9R)-8-(3,4-dimethoxyphenyl)-11-(4-fluorophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-sulfamoylphenyl)acetamide.
| Compound Name | 2-[(1R,8R,9R)-8-(3,4-dimethoxyphenyl)-11-(4-fluorophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 19249729 |
| Molecular Formula | C30H25FN4O8S3 |
| Molecular Weight | 684.75 g/mol |
| Exact Mass | 684.08 |
| IUPAC Name | 2-[(1R,8R,9R)-8-(3,4-dimethoxyphenyl)-11-(4-fluorophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-sulfamoylphenyl)acetamide |
| SMILES | COc1ccc([C@@H]2c3sc(=O)n(CC(=O)Nc4ccc(S(N)(=O)=O)cc4)c3S[C@H]3C(=O)N(c4ccc(F)cc4)C(=O)[C@@H]23)cc1OC |
| InChI | InChI=1S/C30H25FN4O8S3/c1-42-20-12-3-15(13-21(20)43-2)23-24-25(28(38)35(27(24)37)18-8-4-16(31)5-9-18)44-29-26(23)45-30(39)34(29)14-22(36)33-17-6-10-19(11-7-17)46(32,40)41/h3-13,23-25H,14H2,1-2H3,(H,33,36)(H2,32,40,41)/t23-,24-,25+/m0/s1 |
| InChIKey | HYKFKFDUFTXXAL-CCDWMCETSA-N |
| XLogP | 3.15 |
| TPSA | 167.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.75 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|