C25H21FN4O7S2 — CID 18862787
(1S,8R,9S)-8-(3,4-dimethoxyphenyl)-4-[2-(4-fluoroanilino)-2-oxoethyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-11-carboxamide (PubChem CID 18862787) has the molecular formula C25H21FN4O7S2 and a molecular weight of 572.60 g/mol. Its IUPAC name is (1S,8R,9S)-8-(3,4-dimethoxyphenyl)-4-[2-(4-fluoroanilino)-2-oxoethyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-11-carboxamide.
| Compound Name | (1S,8R,9S)-8-(3,4-dimethoxyphenyl)-4-[2-(4-fluoroanilino)-2-oxoethyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-11-carboxamide |
|---|---|
| PubChem CID | 18862787 |
| Molecular Formula | C25H21FN4O7S2 |
| Molecular Weight | 572.60 g/mol |
| Exact Mass | 572.08 |
| IUPAC Name | (1S,8R,9S)-8-(3,4-dimethoxyphenyl)-4-[2-(4-fluoroanilino)-2-oxoethyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-11-carboxamide |
| SMILES | COc1ccc([C@@H]2c3sc(=O)n(CC(=O)Nc4ccc(F)cc4)c3S[C@@H]3C(=O)N(C(N)=O)C(=O)[C@H]23)cc1OC |
| InChI | InChI=1S/C25H21FN4O7S2/c1-36-14-8-3-11(9-15(14)37-2)17-18-19(22(33)30(21(18)32)24(27)34)38-23-20(17)39-25(35)29(23)10-16(31)28-13-6-4-12(26)5-7-13/h3-9,17-19H,10H2,1-2H3,(H2,27,34)(H,28,31)/t17-,18+,19-/m0/s1 |
| InChIKey | DKHMGOSBCURVIA-OTWHNJEPSA-N |
| XLogP | 2.37 |
| TPSA | 150.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.60 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|