C24H20N4O7S2 — CID 43846472
(8R)-4-(2-anilino-2-oxoethyl)-8-(4-hydroxy-3-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-11-carboxamide (PubChem CID 43846472) has the molecular formula C24H20N4O7S2 and a molecular weight of 540.58 g/mol. Its IUPAC name is (8R)-4-(2-anilino-2-oxoethyl)-8-(4-hydroxy-3-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-11-carboxamide.
| Compound Name | (8R)-4-(2-anilino-2-oxoethyl)-8-(4-hydroxy-3-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-11-carboxamide |
|---|---|
| PubChem CID | 43846472 |
| Molecular Formula | C24H20N4O7S2 |
| Molecular Weight | 540.58 g/mol |
| Exact Mass | 540.08 |
| IUPAC Name | (8R)-4-(2-anilino-2-oxoethyl)-8-(4-hydroxy-3-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-11-carboxamide |
| SMILES | COc1cc([C@@H]2c3sc(=O)n(CC(=O)Nc4ccccc4)c3SC3C(=O)N(C(N)=O)C(=O)C32)ccc1O |
| InChI | InChI=1S/C24H20N4O7S2/c1-35-14-9-11(7-8-13(14)29)16-17-18(21(32)28(20(17)31)23(25)33)36-22-19(16)37-24(34)27(22)10-15(30)26-12-5-3-2-4-6-12/h2-9,16-18,29H,10H2,1H3,(H2,25,33)(H,26,30)/t16-,17?,18?/m0/s1 |
| InChIKey | IYMYFIVTCYMIFQ-AOCRQIFASA-N |
| XLogP | 1.93 |
| TPSA | 161.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.58 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|